C17H27N — CID 54505284
2,6-dicyclohexyl-2,5-dihydropyridine (PubChem CID 54505284) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 2,6-dicyclohexyl-2,5-dihydropyridine.
| Compound Name | 2,6-dicyclohexyl-2,5-dihydropyridine |
|---|---|
| PubChem CID | 54505284 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2,6-dicyclohexyl-2,5-dihydropyridine |
| SMILES | C1=CC(C2CCCCC2)N=C(C2CCCCC2)C1 |
| InChI | InChI=1S/C17H27N/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h7,12,14-16H,1-6,8-11,13H2 |
| InChIKey | WLXSYYBJJNYTDZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|