C21H36N3O5+ — CID 57124945
(2S)-1-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 57124945) has the molecular formula C21H36N3O5+ and a molecular weight of 410.54 g/mol. Its IUPAC name is (2S)-1-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-1-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 57124945 |
| Molecular Formula | C21H36N3O5+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (2S)-1-(5-cyclohexyl-2-oxooxolan-3-yl)-1-[(2S)-2,6-diaminohexanoyl]pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)[N+]1(C2CC(C3CCCCC3)OC2=O)CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H35N3O5/c22-11-5-4-9-15(23)19(25)24(12-6-10-16(24)20(26)27)17-13-18(29-21(17)28)14-7-2-1-3-8-14/h14-18H,1-13,22-23H2/p+1/t15-,16-,17?,18?,24?/m0/s1 |
| InChIKey | HGAOEQAPMSOVJR-BGMGDHOMSA-O |
| XLogP | 1.30 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|