C18H21ClN4O2 — CID 57125891
6-[1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methylamino]ethyl]pyridazine-3-carboxamide (PubChem CID 57125891) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is 6-[1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methylamino]ethyl]pyridazine-3-carboxamide.
| Compound Name | 6-[1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methylamino]ethyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 57125891 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 6-[1-[[5-chloro-2-(cyclopropylmethoxy)phenyl]methylamino]ethyl]pyridazine-3-carboxamide |
| SMILES | CC(NCc1cc(Cl)ccc1OCC1CC1)c1ccc(C(N)=O)nn1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-11(15-5-6-16(18(20)24)23-22-15)21-9-13-8-14(19)4-7-17(13)25-10-12-2-3-12/h4-8,11-12,21H,2-3,9-10H2,1H3,(H2,20,24) |
| InChIKey | XYUQYFVBWBOWHU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |