C24H23F3N2O5 — CID 57126391
2-oxo-2-[1-[4-oxo-4-[N-[[4-(trifluoromethyl)phenyl]methyl]anilino]butanoyl]pyrrolidin-2-yl]acetic acid (PubChem CID 57126391) has the molecular formula C24H23F3N2O5 and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-oxo-2-[1-[4-oxo-4-[N-[[4-(trifluoromethyl)phenyl]methyl]anilino]butanoyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-oxo-2-[1-[4-oxo-4-[N-[[4-(trifluoromethyl)phenyl]methyl]anilino]butanoyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 57126391 |
| Molecular Formula | C24H23F3N2O5 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-oxo-2-[1-[4-oxo-4-[N-[[4-(trifluoromethyl)phenyl]methyl]anilino]butanoyl]pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)C(=O)C1CCCN1C(=O)CCC(=O)N(Cc1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23F3N2O5/c25-24(26,27)17-10-8-16(9-11-17)15-29(18-5-2-1-3-6-18)21(31)13-12-20(30)28-14-4-7-19(28)22(32)23(33)34/h1-3,5-6,8-11,19H,4,7,12-15H2,(H,33,34) |
| InChIKey | YVKQIALUULYLJT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|