C23H43NO4 — CID 57126820
tert-butyl (4S,5S)-4-(cyclohexylmethyl)-5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 57126820) has the molecular formula C23H43NO4 and a molecular weight of 397.60 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-(cyclohexylmethyl)-5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-(cyclohexylmethyl)-5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 57126820 |
| Molecular Formula | C23H43NO4 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.32 |
| IUPAC Name | tert-butyl (4S,5S)-4-(cyclohexylmethyl)-5-(6-hydroxyhexyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2CCCCC2)[C@H](CCCCCCO)OC1(C)C |
| InChI | InChI=1S/C23H43NO4/c1-22(2,3)28-21(26)24-19(17-18-13-9-8-10-14-18)20(27-23(24,4)5)15-11-6-7-12-16-25/h18-20,25H,6-17H2,1-5H3/t19-,20-/m0/s1 |
| InChIKey | VZNFSCOBHIPYQZ-PMACEKPBSA-N |
| XLogP | 5.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|