C27H42NO2+ — CID 57127528
(2,6-dimethyl-4-phenylheptan-4-yl)-dimethyl-[2-(2-phenoxyethoxy)ethyl]azanium (PubChem CID 57127528) has the molecular formula C27H42NO2+ and a molecular weight of 412.64 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylheptan-4-yl)-dimethyl-[2-(2-phenoxyethoxy)ethyl]azanium.
| Compound Name | (2,6-dimethyl-4-phenylheptan-4-yl)-dimethyl-[2-(2-phenoxyethoxy)ethyl]azanium |
|---|---|
| PubChem CID | 57127528 |
| Molecular Formula | C27H42NO2+ |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | (2,6-dimethyl-4-phenylheptan-4-yl)-dimethyl-[2-(2-phenoxyethoxy)ethyl]azanium |
| SMILES | CC(C)CC(CC(C)C)(c1ccccc1)[N+](C)(C)CCOCCOc1ccccc1 |
| InChI | InChI=1S/C27H42NO2/c1-23(2)21-27(22-24(3)4,25-13-9-7-10-14-25)28(5,6)17-18-29-19-20-30-26-15-11-8-12-16-26/h7-16,23-24H,17-22H2,1-6H3/q+1 |
| InChIKey | JWSQWXWJDSOPDU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|