C27H42ClNO2 — CID 141051108
benzyl-methyl-(7-methyloctyl)-[2-(2-phenoxyethoxy)ethyl]azanium chloride (PubChem CID 141051108) has the molecular formula C27H42ClNO2 and a molecular weight of 448.09 g/mol. Its IUPAC name is benzyl-methyl-(7-methyloctyl)-[2-(2-phenoxyethoxy)ethyl]azanium chloride.
| Compound Name | benzyl-methyl-(7-methyloctyl)-[2-(2-phenoxyethoxy)ethyl]azanium chloride |
|---|---|
| PubChem CID | 141051108 |
| Molecular Formula | C27H42ClNO2 |
| Molecular Weight | 448.09 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | benzyl-methyl-(7-methyloctyl)-[2-(2-phenoxyethoxy)ethyl]azanium chloride |
| SMILES | CC(C)CCCCCC[N+](C)(CCOCCOc1ccccc1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C27H42NO2.ClH/c1-25(2)14-8-4-5-13-19-28(3,24-26-15-9-6-10-16-26)20-21-29-22-23-30-27-17-11-7-12-18-27;/h6-7,9-12,15-18,25H,4-5,8,13-14,19-24H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LUSBRARYRKIZKL-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.09 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|