C25H38ClNO — CID 161190016
benzyl-(2,6-dimethylheptan-4-yl)-methyl-(2-phenoxyethyl)azanium chloride (PubChem CID 161190016) has the molecular formula C25H38ClNO and a molecular weight of 404.04 g/mol. Its IUPAC name is benzyl-(2,6-dimethylheptan-4-yl)-methyl-(2-phenoxyethyl)azanium chloride.
| Compound Name | benzyl-(2,6-dimethylheptan-4-yl)-methyl-(2-phenoxyethyl)azanium chloride |
|---|---|
| PubChem CID | 161190016 |
| Molecular Formula | C25H38ClNO |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | benzyl-(2,6-dimethylheptan-4-yl)-methyl-(2-phenoxyethyl)azanium chloride |
| SMILES | CC(C)CC(CC(C)C)[N+](C)(CCOc1ccccc1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C25H38NO.ClH/c1-21(2)18-24(19-22(3)4)26(5,20-23-12-8-6-9-13-23)16-17-27-25-14-10-7-11-15-25;/h6-15,21-22,24H,16-20H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | UTOZBVDBGXWDFZ-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|