C25H38NO2+ — CID 87334529
benzyl-dimethyl-[2-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]ethoxy]azanium (PubChem CID 87334529) has the molecular formula C25H38NO2+ and a molecular weight of 384.58 g/mol. Its IUPAC name is benzyl-dimethyl-[2-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]ethoxy]azanium.
| Compound Name | benzyl-dimethyl-[2-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]ethoxy]azanium |
|---|---|
| PubChem CID | 87334529 |
| Molecular Formula | C25H38NO2+ |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | benzyl-dimethyl-[2-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]ethoxy]azanium |
| SMILES | CC(C)C(c1ccc(OCCO[N+](C)(C)Cc2ccccc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C25H38NO2/c1-20(2)24(25(3,4)5)22-13-15-23(16-14-22)27-17-18-28-26(6,7)19-21-11-9-8-10-12-21/h8-16,20,24H,17-19H2,1-7H3/q+1 |
| InChIKey | NBBSRXNLARSURX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|