About benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride
benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride (PubChem CID 87318338) has the molecular formula C21H26ClNOS
and a molecular weight of 375.97 g/mol. Its IUPAC name is benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride.
Molecular Properties
| Compound Name | benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride |
| PubChem CID | 87318338 |
| Molecular Formula | C21H26ClNOS |
| Molecular Weight | 375.97 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride |
| SMILES | C[N+](C)(CCOc1ccccc1)Cc1cccs1.[Cl-].c1ccccc1 |
| InChI | InChI=1S/C15H20NOS.C6H6.ClH/c1-16(2,13-15-9-6-12-18-15)10-11-17-14-7-4-3-5-8-14;1-2-4-6-5-3-1;/h3-9,12H,10-11,13H2,1-2H3;1-6H;1H/q+1;;/p-1 |
| InChIKey | INTXNUFBJAIGRZ-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.97 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride?
The IUPAC name of benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride (CID 87318338) is benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride.
What is the SMILES notation for benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride?
The canonical SMILES for benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride is C[N+](C)(CCOc1ccccc1)Cc1cccs1.[Cl-].c1ccccc1.
What is the InChIKey of benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride?
The InChIKey is INTXNUFBJAIGRZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H20NOS.C6H6.ClH/c1-16(2,13-15-9-6-12-18-15)10-11-17-14-7-4-3-5-8-14;1-2-4-6-5-3-1;/h3-9,12H,10-11,13H2,1-2H3;1-6H;1H/q+1;;/p-1.
What are the key properties of benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride?
benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride has a molecular weight of 375.97 g/mol, XLogP of 2.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride is sourced from PubChem (CID 87318338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).