C13H13Cl2NO2 — CID 57127681
1-(1,3-dichloro-1-phenylpropyl)pyrrole-2,5-diol (PubChem CID 57127681) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-(1,3-dichloro-1-phenylpropyl)pyrrole-2,5-diol.
| Compound Name | 1-(1,3-dichloro-1-phenylpropyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 57127681 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1-(1,3-dichloro-1-phenylpropyl)pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1C(Cl)(CCCl)c1ccccc1 |
| InChI | InChI=1S/C13H13Cl2NO2/c14-9-8-13(15,10-4-2-1-3-5-10)16-11(17)6-7-12(16)18/h1-7,17-18H,8-9H2 |
| InChIKey | RAVPCVPAMJUQIC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|