C20H21ClO4S — CID 57127688
ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate (PubChem CID 57127688) has the molecular formula C20H21ClO4S and a molecular weight of 392.90 g/mol. Its IUPAC name is ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate.
| Compound Name | ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate |
|---|---|
| PubChem CID | 57127688 |
| Molecular Formula | C20H21ClO4S |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | ethyl 2-[(4-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]butanoate |
| SMILES | CCOC(=O)C(CC)=C(c1ccc(Cl)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21ClO4S/c1-4-18(20(22)25-5-2)19(14-6-10-16(21)11-7-14)15-8-12-17(13-9-15)26(3,23)24/h6-13H,4-5H2,1-3H3 |
| InChIKey | OVRHMZMQTPLJCH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|