C19H28N2O7S — CID 57128844
[[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino] 2-cyclohexyl-2-(ethylsulfonylamino)acetate (PubChem CID 57128844) has the molecular formula C19H28N2O7S and a molecular weight of 428.51 g/mol. Its IUPAC name is [[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino] 2-cyclohexyl-2-(ethylsulfonylamino)acetate.
| Compound Name | [[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino] 2-cyclohexyl-2-(ethylsulfonylamino)acetate |
|---|---|
| PubChem CID | 57128844 |
| Molecular Formula | C19H28N2O7S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [[2-(4-hydroxy-3-methoxyphenyl)acetyl]amino] 2-cyclohexyl-2-(ethylsulfonylamino)acetate |
| SMILES | CCS(=O)(=O)NC(C(=O)ONC(=O)Cc1ccc(O)c(OC)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H28N2O7S/c1-3-29(25,26)21-18(14-7-5-4-6-8-14)19(24)28-20-17(23)12-13-9-10-15(22)16(11-13)27-2/h9-11,14,18,21-22H,3-8,12H2,1-2H3,(H,20,23) |
| InChIKey | BPLUYJCBDJQSFC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|