C19H30N2O5S — CID 59942467
2-cyclohexyl-2-(ethylsulfonylamino)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide (PubChem CID 59942467) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-cyclohexyl-2-(ethylsulfonylamino)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-cyclohexyl-2-(ethylsulfonylamino)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 59942467 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-cyclohexyl-2-(ethylsulfonylamino)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acetamide |
| SMILES | CCS(=O)(=O)NC(C(=O)NCCc1ccc(O)c(OC)c1)C1CCCCC1 |
| InChI | InChI=1S/C19H30N2O5S/c1-3-27(24,25)21-18(15-7-5-4-6-8-15)19(23)20-12-11-14-9-10-16(22)17(13-14)26-2/h9-10,13,15,18,21-22H,3-8,11-12H2,1-2H3,(H,20,23) |
| InChIKey | SJBWEMHIODINEB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |