About 2-(2-aminoethoxy)ethenyl 2-aminoacetate
2-(2-aminoethoxy)ethenyl 2-aminoacetate (PubChem CID 57136578) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethenyl 2-aminoacetate.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)ethenyl 2-aminoacetate |
| PubChem CID | 57136578 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 2-(2-aminoethoxy)ethenyl 2-aminoacetate |
| SMILES | NCCOC=COC(=O)CN |
| InChI | InChI=1S/C6H12N2O3/c7-1-2-10-3-4-11-6(9)5-8/h3-4H,1-2,5,7-8H2 |
| InChIKey | ZBBQPGCFQPATHD-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethoxy)ethenyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)ethenyl 2-aminoacetate?
The IUPAC name of 2-(2-aminoethoxy)ethenyl 2-aminoacetate (CID 57136578) is 2-(2-aminoethoxy)ethenyl 2-aminoacetate.
What is the SMILES notation for 2-(2-aminoethoxy)ethenyl 2-aminoacetate?
The canonical SMILES for 2-(2-aminoethoxy)ethenyl 2-aminoacetate is NCCOC=COC(=O)CN.
What is the InChIKey of 2-(2-aminoethoxy)ethenyl 2-aminoacetate?
The InChIKey is ZBBQPGCFQPATHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3/c7-1-2-10-3-4-11-6(9)5-8/h3-4H,1-2,5,7-8H2.
What are the key properties of 2-(2-aminoethoxy)ethenyl 2-aminoacetate?
2-(2-aminoethoxy)ethenyl 2-aminoacetate has a molecular weight of 160.17 g/mol, XLogP of -1.07, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)ethenyl 2-aminoacetate is sourced from PubChem (CID 57136578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).