C52H32N4S4 — CID 57137168
5,10,15,20-tetrakis(1-benzothiophen-2-yl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 57137168) has the molecular formula C52H32N4S4 and a molecular weight of 841.12 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-benzothiophen-2-yl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(1-benzothiophen-2-yl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 57137168 |
| Molecular Formula | C52H32N4S4 |
| Molecular Weight | 841.12 g/mol |
| Exact Mass | 840.15 |
| IUPAC Name | 5,10,15,20-tetrakis(1-benzothiophen-2-yl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | c1ccc2sc(C3=c4ccc([nH]4)=C(c4cc5ccccc5s4)c4ccc([nH]4)C(c4cc5ccccc5s4)=c4ccc([nH]4)=C(c4cc5ccccc5s4)c4ccc3[nH]4)cc2c1 |
| InChI | InChI=1S/C52H32N4S4/c1-5-13-41-29(9-1)25-45(57-41)49-33-17-19-35(53-33)50(46-26-30-10-2-6-14-42(30)58-46)37-21-23-39(55-37)52(48-28-32-12-4-8-16-44(32)60-48)40-24-22-38(56-40)51(36-20-18-34(49)54-36)47-27-31-11-3-7-15-43(31)59-47/h1-28,53-56H |
| InChIKey | XCWISEHTFMEYAL-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.12 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |