C17H15N3S — CID 57137659
1-(4-cyanophenyl)-1-(2,3-dihydro-1H-inden-1-yl)thiourea (PubChem CID 57137659) has the molecular formula C17H15N3S and a molecular weight of 293.40 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-1-(2,3-dihydro-1H-inden-1-yl)thiourea.
| Compound Name | 1-(4-cyanophenyl)-1-(2,3-dihydro-1H-inden-1-yl)thiourea |
|---|---|
| PubChem CID | 57137659 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(4-cyanophenyl)-1-(2,3-dihydro-1H-inden-1-yl)thiourea |
| SMILES | N#Cc1ccc(N(C(N)=S)C2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H15N3S/c18-11-12-5-8-14(9-6-12)20(17(19)21)16-10-7-13-3-1-2-4-15(13)16/h1-6,8-9,16H,7,10H2,(H2,19,21) |
| InChIKey | PSDXFCVQWFLSSC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|