C15H20N4O3 — CID 57137943
2-(8-cyclopentyl-2,6-dioxo-9-propylpurin-3-yl)acetaldehyde (PubChem CID 57137943) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(8-cyclopentyl-2,6-dioxo-9-propylpurin-3-yl)acetaldehyde.
| Compound Name | 2-(8-cyclopentyl-2,6-dioxo-9-propylpurin-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 57137943 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(8-cyclopentyl-2,6-dioxo-9-propylpurin-3-yl)acetaldehyde |
| SMILES | CCCn1c(C2CCCC2)nc2c(=O)[nH]c(=O)n(CC=O)c21 |
| InChI | InChI=1S/C15H20N4O3/c1-2-7-18-12(10-5-3-4-6-10)16-11-13(21)17-15(22)19(8-9-20)14(11)18/h9-10H,2-8H2,1H3,(H,17,21,22) |
| InChIKey | VDTPEAWPMHOQLT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|