C34H40ClN3O7S — CID 57138794
[(2S,3S)-8-chloro-2-(4-methoxyphenyl)-4-oxo-5-[3-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate (PubChem CID 57138794) has the molecular formula C34H40ClN3O7S and a molecular weight of 670.23 g/mol. Its IUPAC name is [(2S,3S)-8-chloro-2-(4-methoxyphenyl)-4-oxo-5-[3-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate.
| Compound Name | [(2S,3S)-8-chloro-2-(4-methoxyphenyl)-4-oxo-5-[3-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
|---|---|
| PubChem CID | 57138794 |
| Molecular Formula | C34H40ClN3O7S |
| Molecular Weight | 670.23 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | [(2S,3S)-8-chloro-2-(4-methoxyphenyl)-4-oxo-5-[3-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]propyl]-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate |
| SMILES | COc1ccc([C@@H]2Sc3cc(Cl)ccc3N(CCCN3CCN(c4cc(OC)c(OC)c(OC)c4)CC3)C(=O)[C@@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C34H40ClN3O7S/c1-22(39)45-32-33(23-7-10-26(41-2)11-8-23)46-30-19-24(35)9-12-27(30)38(34(32)40)14-6-13-36-15-17-37(18-16-36)25-20-28(42-3)31(44-5)29(21-25)43-4/h7-12,19-21,32-33H,6,13-18H2,1-5H3/t32-,33+/m1/s1 |
| InChIKey | BJGBZCRBIJTJAG-SAIUNTKASA-N |
| XLogP | 5.70 |
| TPSA | 90.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.23 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|