C17H9Cl3N2O2 — CID 57139231
6-[2-(3,5-dichlorobenzoyl)pyrrol-2-yl]pyridine-3-carbonyl chloride (PubChem CID 57139231) has the molecular formula C17H9Cl3N2O2 and a molecular weight of 379.63 g/mol. Its IUPAC name is 6-[2-(3,5-dichlorobenzoyl)pyrrol-2-yl]pyridine-3-carbonyl chloride.
| Compound Name | 6-[2-(3,5-dichlorobenzoyl)pyrrol-2-yl]pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 57139231 |
| Molecular Formula | C17H9Cl3N2O2 |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 6-[2-(3,5-dichlorobenzoyl)pyrrol-2-yl]pyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc(C2(C(=O)c3cc(Cl)cc(Cl)c3)C=CC=N2)nc1 |
| InChI | InChI=1S/C17H9Cl3N2O2/c18-12-6-11(7-13(19)8-12)15(23)17(4-1-5-22-17)14-3-2-10(9-21-14)16(20)24/h1-9H |
| InChIKey | UPCYECVXIGJORK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|