C11H18N2O5S2Si — CID 57139252
3-(5-nitro-2-pyridinyl)-1-trimethoxysilylpropane-1,1-dithiol (PubChem CID 57139252) has the molecular formula C11H18N2O5S2Si and a molecular weight of 350.49 g/mol. Its IUPAC name is 3-(5-nitro-2-pyridinyl)-1-trimethoxysilylpropane-1,1-dithiol.
| Compound Name | 3-(5-nitro-2-pyridinyl)-1-trimethoxysilylpropane-1,1-dithiol |
|---|---|
| PubChem CID | 57139252 |
| Molecular Formula | C11H18N2O5S2Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-(5-nitro-2-pyridinyl)-1-trimethoxysilylpropane-1,1-dithiol |
| SMILES | CO[Si](OC)(OC)C(S)(S)CCc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H18N2O5S2Si/c1-16-21(17-2,18-3)11(19,20)7-6-9-4-5-10(8-12-9)13(14)15/h4-5,8,19-20H,6-7H2,1-3H3 |
| InChIKey | ILAIZVOIOISEGF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|