C32H43NO7 — CID 57139665
3-O-benzyl 1-O-methyl 2-[[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butoxy]phenyl]methyl]propanedioate (PubChem CID 57139665) has the molecular formula C32H43NO7 and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl 2-[[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butoxy]phenyl]methyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-methyl 2-[[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 57139665 |
| Molecular Formula | C32H43NO7 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | 3-O-benzyl 1-O-methyl 2-[[4-[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]butoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCCCC2(C(=O)OC(C)(C)C)CCNCC2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H43NO7/c1-31(2,3)40-30(36)32(17-19-33-20-18-32)16-8-9-21-38-26-14-12-24(13-15-26)22-27(28(34)37-4)29(35)39-23-25-10-6-5-7-11-25/h5-7,10-15,27,33H,8-9,16-23H2,1-4H3 |
| InChIKey | JIQMSFISQVVRLB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|