C9H18O4 — CID 57142467
3-[(1R,2R)-2-hydroxycyclohexyl]oxypropane-1,2-diol (PubChem CID 57142467) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-[(1R,2R)-2-hydroxycyclohexyl]oxypropane-1,2-diol.
| Compound Name | 3-[(1R,2R)-2-hydroxycyclohexyl]oxypropane-1,2-diol |
|---|---|
| PubChem CID | 57142467 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-[(1R,2R)-2-hydroxycyclohexyl]oxypropane-1,2-diol |
| SMILES | OCC(O)CO[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C9H18O4/c10-5-7(11)6-13-9-4-2-1-3-8(9)12/h7-12H,1-6H2/t7?,8-,9-/m1/s1 |
| InChIKey | XZULXSLBZRPDAX-CFCGPWAMSA-N |
| XLogP | -0.34 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |