About 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene
1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene (PubChem CID 57143074) has the molecular formula C16H22BrClO2
and a molecular weight of 361.71 g/mol. Its IUPAC name is 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene.
Molecular Properties
| Compound Name | 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene |
| PubChem CID | 57143074 |
| Molecular Formula | C16H22BrClO2 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene |
| SMILES | COC(CBr)(OC)c1ccc(C2CCCCC2Cl)cc1 |
| InChI | InChI=1S/C16H22BrClO2/c1-19-16(11-17,20-2)13-9-7-12(8-10-13)14-5-3-4-6-15(14)18/h7-10,14-15H,3-6,11H2,1-2H3 |
| InChIKey | RRKINZMMLXUOSA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene?
The IUPAC name of 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene (CID 57143074) is 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene.
What is the SMILES notation for 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene?
The canonical SMILES for 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene is COC(CBr)(OC)c1ccc(C2CCCCC2Cl)cc1.
What is the InChIKey of 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene?
The InChIKey is RRKINZMMLXUOSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrClO2/c1-19-16(11-17,20-2)13-9-7-12(8-10-13)14-5-3-4-6-15(14)18/h7-10,14-15H,3-6,11H2,1-2H3.
What are the key properties of 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene?
1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene has a molecular weight of 361.71 g/mol, XLogP of 4.79, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene is sourced from PubChem (CID 57143074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).