C16H22BrClO2 — CID 57143074
1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene (PubChem CID 57143074) has the molecular formula C16H22BrClO2 and a molecular weight of 361.71 g/mol. Its IUPAC name is 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene.
| Compound Name | 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene |
|---|---|
| PubChem CID | 57143074 |
| Molecular Formula | C16H22BrClO2 |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-(2-bromo-1,1-dimethoxyethyl)-4-(2-chlorocyclohexyl)benzene |
| SMILES | COC(CBr)(OC)c1ccc(C2CCCCC2Cl)cc1 |
| InChI | InChI=1S/C16H22BrClO2/c1-19-16(11-17,20-2)13-9-7-12(8-10-13)14-5-3-4-6-15(14)18/h7-10,14-15H,3-6,11H2,1-2H3 |
| InChIKey | RRKINZMMLXUOSA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|