C21H25FN4O4 — CID 57145393
1-cyclopropyl-6-fluoro-7-[4-[2-(methoxyamino)prop-1-enyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 57145393) has the molecular formula C21H25FN4O4 and a molecular weight of 416.45 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[4-[2-(methoxyamino)prop-1-enyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[4-[2-(methoxyamino)prop-1-enyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 57145393 |
| Molecular Formula | C21H25FN4O4 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[4-[2-(methoxyamino)prop-1-enyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CONC(C)=CN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1 |
| InChI | InChI=1S/C21H25FN4O4/c1-13(23-30-2)11-24-5-7-25(8-6-24)19-10-18-15(9-17(19)22)20(27)16(21(28)29)12-26(18)14-3-4-14/h9-12,14,23H,3-8H2,1-2H3,(H,28,29) |
| InChIKey | BVPZBWYMLGWZQB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|