C16H12ClNO5S — CID 5714708
4-{[5-(4-Chlorophenyl)-2-(methoxycarbonyl)-3-thienyl]amino}-4-oxo-2-butenoic acid (PubChem CID 5714708) has the molecular formula C16H12ClNO5S and a molecular weight of 365.80 g/mol. Its IUPAC name is (E)-4-[[5-(4-chlorophenyl)-2-methoxycarbonylthiophen-3-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-{[5-(4-Chlorophenyl)-2-(methoxycarbonyl)-3-thienyl]amino}-4-oxo-2-butenoic acid |
|---|---|
| PubChem CID | 5714708 |
| Molecular Formula | C16H12ClNO5S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | (E)-4-[[5-(4-chlorophenyl)-2-methoxycarbonylthiophen-3-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | COC(=O)C1=C(C=C(S1)C2=CC=C(C=C2)Cl)NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H12ClNO5S/c1-23-16(22)15-11(18-13(19)6-7-14(20)21)8-12(24-15)9-2-4-10(17)5-3-9/h2-8H,1H3,(H,18,19)(H,20,21)/b7-6+ |
| InChIKey | TXGSTHFVVXXQSX-VOTSOKGWSA-N |
| XLogP | 3.60 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 519 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|