About trihydroxyoxidanium;heptahydrate
trihydroxyoxidanium;heptahydrate (PubChem CID 57149570) has the molecular formula H17O11+
and a molecular weight of 193.12 g/mol. Its IUPAC name is trihydroxyoxidanium;heptahydrate.
Molecular Properties
| Compound Name | trihydroxyoxidanium;heptahydrate |
| PubChem CID | 57149570 |
| Molecular Formula | H17O11+ |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | trihydroxyoxidanium;heptahydrate |
| SMILES | O.O.O.O.O.O.O.O[O+](O)O |
| InChI | InChI=1S/H3O4.7H2O/c1-4(2)3;;;;;;;/h1-3H;7*1H2/q+1;;;;;;; |
| InChIKey | HPIBEZMNGHBGLS-UHFFFAOYSA-N |
| XLogP | -5.82 |
| TPSA | 283.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze trihydroxyoxidanium;heptahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihydroxyoxidanium;heptahydrate?
The IUPAC name of trihydroxyoxidanium;heptahydrate (CID 57149570) is trihydroxyoxidanium;heptahydrate.
What is the SMILES notation for trihydroxyoxidanium;heptahydrate?
The canonical SMILES for trihydroxyoxidanium;heptahydrate is O.O.O.O.O.O.O.O[O+](O)O.
What is the InChIKey of trihydroxyoxidanium;heptahydrate?
The InChIKey is HPIBEZMNGHBGLS-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O4.7H2O/c1-4(2)3;;;;;;;/h1-3H;7*1H2/q+1;;;;;;;.
What are the key properties of trihydroxyoxidanium;heptahydrate?
trihydroxyoxidanium;heptahydrate has a molecular weight of 193.12 g/mol, XLogP of -5.82, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trihydroxyoxidanium;heptahydrate is sourced from PubChem (CID 57149570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).