C22H25ClO5 — CID 57150737
(8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,6-dione (PubChem CID 57150737) has the molecular formula C22H25ClO5 and a molecular weight of 404.89 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 57150737 |
| Molecular Formula | C22H25ClO5 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-17-(2-chloroacetyl)-11,17-dihydroxy-10,13-dimethyl-16-methylidene-8,9,11,12,14,15-hexahydro-7H-cyclopenta[a]phenanthrene-3,6-dione |
| SMILES | C=C1C[C@H]2[C@@H]3CC(=O)C4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@]2(C)[C@@]1(O)C(=O)CCl |
| InChI | InChI=1S/C22H25ClO5/c1-11-6-14-13-8-16(25)15-7-12(24)4-5-20(15,2)19(13)17(26)9-21(14,3)22(11,28)18(27)10-23/h4-5,7,13-14,17,19,26,28H,1,6,8-10H2,2-3H3/t13-,14-,17?,19+,20-,21-,22-/m0/s1 |
| InChIKey | CIJPJHTWVFDYLU-ODZIBOKPSA-N |
| XLogP | 2.15 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|