C24H29ClO7 — CID 22810873
chloromethyl (8S,9S,10R,11S,13S,14S,16S,17R)-6-acetyloxy-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 22810873) has the molecular formula C24H29ClO7 and a molecular weight of 464.94 g/mol. Its IUPAC name is chloromethyl (8S,9S,10R,11S,13S,14S,16S,17R)-6-acetyloxy-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | chloromethyl (8S,9S,10R,11S,13S,14S,16S,17R)-6-acetyloxy-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 22810873 |
| Molecular Formula | C24H29ClO7 |
| Molecular Weight | 464.94 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | chloromethyl (8S,9S,10R,11S,13S,14S,16S,17R)-6-acetyloxy-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(=O)OC1=C[C@@H]2[C@H]([C@@H](O)C[C@@]3(C)[C@H]2C[C@H](C)[C@]3(O)C(=O)OCCl)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C24H29ClO7/c1-12-7-16-15-9-19(32-13(2)26)17-8-14(27)5-6-22(17,3)20(15)18(28)10-23(16,4)24(12,30)21(29)31-11-25/h5-6,8-9,12,15-16,18,20,28,30H,7,10-11H2,1-4H3/t12-,15-,16-,18-,20+,22-,23-,24-/m0/s1 |
| InChIKey | ICOJLNORQGDFJK-NXZIJPGZSA-N |
| XLogP | 2.65 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.94 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|