C24H31N3O3 — CID 57151693
3-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-methyl-1-(3-phenylprop-2-enoylamino)propan-2-yl]propanamide (PubChem CID 57151693) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-methyl-1-(3-phenylprop-2-enoylamino)propan-2-yl]propanamide.
| Compound Name | 3-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-methyl-1-(3-phenylprop-2-enoylamino)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 57151693 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-amino-3-(4-hydroxy-2,6-dimethylphenyl)-N-[2-methyl-1-(3-phenylprop-2-enoylamino)propan-2-yl]propanamide |
| SMILES | Cc1cc(O)cc(C)c1C(N)CC(=O)NC(C)(C)CNC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-16-12-19(28)13-17(2)23(16)20(25)14-22(30)27-24(3,4)15-26-21(29)11-10-18-8-6-5-7-9-18/h5-13,20,28H,14-15,25H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | MZGLMODCRVUJAY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|