C10H19N3 — CID 57152754
N'-[2-(2-ethylpyrrol-2-yl)ethyl]ethane-1,2-diamine (PubChem CID 57152754) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N'-[2-(2-ethylpyrrol-2-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2-ethylpyrrol-2-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 57152754 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N'-[2-(2-ethylpyrrol-2-yl)ethyl]ethane-1,2-diamine |
| SMILES | CCC1(CCNCCN)C=CC=N1 |
| InChI | InChI=1S/C10H19N3/c1-2-10(4-3-7-13-10)5-8-12-9-6-11/h3-4,7,12H,2,5-6,8-9,11H2,1H3 |
| InChIKey | IIIYNBLAUDAQCV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|