C13H22N2 — CID 142041410
(5Z,8Z)-3-methyl-N-propyl-4,7-dihydro-2H-azecin-3-amine (PubChem CID 142041410) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (5Z,8Z)-3-methyl-N-propyl-4,7-dihydro-2H-azecin-3-amine.
| Compound Name | (5Z,8Z)-3-methyl-N-propyl-4,7-dihydro-2H-azecin-3-amine |
|---|---|
| PubChem CID | 142041410 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (5Z,8Z)-3-methyl-N-propyl-4,7-dihydro-2H-azecin-3-amine |
| SMILES | CCCNC1(C)C/C=C\C/C=C\C=N/C1 |
| InChI | InChI=1S/C13H22N2/c1-3-10-15-13(2)9-7-5-4-6-8-11-14-12-13/h5-8,11,15H,3-4,9-10,12H2,1-2H3/b7-5-,8-6-,14-11- |
| InChIKey | KFCDAEQYCMBAMY-WAFZICQLSA-N |
| XLogP | 2.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|