About 5,9-diazaspiro[3.6]deca-2,5-diene
5,9-diazaspiro[3.6]deca-2,5-diene (PubChem CID 91328736) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 5,9-diazaspiro[3.6]deca-2,5-diene.
Molecular Properties
| Compound Name | 5,9-diazaspiro[3.6]deca-2,5-diene |
| PubChem CID | 91328736 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 5,9-diazaspiro[3.6]deca-2,5-diene |
| SMILES | C1=CC2(C1)CNCCC=N2 |
| InChI | InChI=1S/C8H12N2/c1-3-8(4-1)7-9-5-2-6-10-8/h1,3,6,9H,2,4-5,7H2 |
| InChIKey | LYDOCIUNKPESDR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,9-diazaspiro[3.6]deca-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-diazaspiro[3.6]deca-2,5-diene?
The IUPAC name of 5,9-diazaspiro[3.6]deca-2,5-diene (CID 91328736) is 5,9-diazaspiro[3.6]deca-2,5-diene.
What is the SMILES notation for 5,9-diazaspiro[3.6]deca-2,5-diene?
The canonical SMILES for 5,9-diazaspiro[3.6]deca-2,5-diene is C1=CC2(C1)CNCCC=N2.
What is the InChIKey of 5,9-diazaspiro[3.6]deca-2,5-diene?
The InChIKey is LYDOCIUNKPESDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-8(4-1)7-9-5-2-6-10-8/h1,3,6,9H,2,4-5,7H2.
What are the key properties of 5,9-diazaspiro[3.6]deca-2,5-diene?
5,9-diazaspiro[3.6]deca-2,5-diene has a molecular weight of 136.20 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-diazaspiro[3.6]deca-2,5-diene is sourced from PubChem (CID 91328736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).