C20H30O3 — CID 57157289
4-cycloheptyl-4-(2,5-dimethoxy-4-methylphenyl)butanal (PubChem CID 57157289) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-cycloheptyl-4-(2,5-dimethoxy-4-methylphenyl)butanal.
| Compound Name | 4-cycloheptyl-4-(2,5-dimethoxy-4-methylphenyl)butanal |
|---|---|
| PubChem CID | 57157289 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 4-cycloheptyl-4-(2,5-dimethoxy-4-methylphenyl)butanal |
| SMILES | COc1cc(C(CCC=O)C2CCCCCC2)c(OC)cc1C |
| InChI | InChI=1S/C20H30O3/c1-15-13-20(23-3)18(14-19(15)22-2)17(11-8-12-21)16-9-6-4-5-7-10-16/h12-14,16-17H,4-11H2,1-3H3 |
| InChIKey | IFHVLSZWAUCLTR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|