C36H36N4O5 — CID 57158497
tert-butyl 2-[4-[[N-butanoyl-5-(1-methylbenzimidazol-2-yl)-2-nitroanilino]methyl]phenyl]benzoate (PubChem CID 57158497) has the molecular formula C36H36N4O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is tert-butyl 2-[4-[[N-butanoyl-5-(1-methylbenzimidazol-2-yl)-2-nitroanilino]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[N-butanoyl-5-(1-methylbenzimidazol-2-yl)-2-nitroanilino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 57158497 |
| Molecular Formula | C36H36N4O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | tert-butyl 2-[4-[[N-butanoyl-5-(1-methylbenzimidazol-2-yl)-2-nitroanilino]methyl]phenyl]benzoate |
| SMILES | CCCC(=O)N(Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1)c1cc(-c2nc3ccccc3n2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C36H36N4O5/c1-6-11-33(41)39(23-24-16-18-25(19-17-24)27-12-7-8-13-28(27)35(42)45-36(2,3)4)32-22-26(20-21-31(32)40(43)44)34-37-29-14-9-10-15-30(29)38(34)5/h7-10,12-22H,6,11,23H2,1-5H3 |
| InChIKey | YUTHCIJDMPEZQU-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|