C22H31NO — CID 57158642
4-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexan-1-ol (PubChem CID 57158642) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 4-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexan-1-ol.
| Compound Name | 4-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 57158642 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 4-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexan-1-ol |
| SMILES | CCCCCC1(Cc2ccc(C3CCC(O)CC3)cc2)C=CC=N1 |
| InChI | InChI=1S/C22H31NO/c1-2-3-4-14-22(15-5-16-23-22)17-18-6-8-19(9-7-18)20-10-12-21(24)13-11-20/h5-9,15-16,20-21,24H,2-4,10-14,17H2,1H3 |
| InChIKey | RKTYHJRXMHMAND-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|