C21H31NO2 — CID 56977286
9-[2-(2-phenylethyl)pyrrol-2-yl]nonane-1,8-diol (PubChem CID 56977286) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 9-[2-(2-phenylethyl)pyrrol-2-yl]nonane-1,8-diol.
| Compound Name | 9-[2-(2-phenylethyl)pyrrol-2-yl]nonane-1,8-diol |
|---|---|
| PubChem CID | 56977286 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 9-[2-(2-phenylethyl)pyrrol-2-yl]nonane-1,8-diol |
| SMILES | OCCCCCCCC(O)CC1(CCc2ccccc2)C=CC=N1 |
| InChI | InChI=1S/C21H31NO2/c23-17-8-3-1-2-7-12-20(24)18-21(14-9-16-22-21)15-13-19-10-5-4-6-11-19/h4-6,9-11,14,16,20,23-24H,1-3,7-8,12-13,15,17-18H2 |
| InChIKey | SHWOAMCELCLDEP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|