C15H16F3NO2 — CID 91481850
2-[(2-benzylpyrrol-2-yl)methyl]-3,3,3-trifluoropropane-1,2-diol (PubChem CID 91481850) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-[(2-benzylpyrrol-2-yl)methyl]-3,3,3-trifluoropropane-1,2-diol.
| Compound Name | 2-[(2-benzylpyrrol-2-yl)methyl]-3,3,3-trifluoropropane-1,2-diol |
|---|---|
| PubChem CID | 91481850 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-[(2-benzylpyrrol-2-yl)methyl]-3,3,3-trifluoropropane-1,2-diol |
| SMILES | OCC(O)(CC1(Cc2ccccc2)C=CC=N1)C(F)(F)F |
| InChI | InChI=1S/C15H16F3NO2/c16-15(17,18)14(21,11-20)10-13(7-4-8-19-13)9-12-5-2-1-3-6-12/h1-8,20-21H,9-11H2 |
| InChIKey | SZIUEVRVDBXQIF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |