C17H20N2O2 — CID 57114717
3-[3-benzyl-2-(2,3-dihydroxypropyl)pyrrol-2-yl]propanenitrile (PubChem CID 57114717) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[3-benzyl-2-(2,3-dihydroxypropyl)pyrrol-2-yl]propanenitrile.
| Compound Name | 3-[3-benzyl-2-(2,3-dihydroxypropyl)pyrrol-2-yl]propanenitrile |
|---|---|
| PubChem CID | 57114717 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3-[3-benzyl-2-(2,3-dihydroxypropyl)pyrrol-2-yl]propanenitrile |
| SMILES | N#CCCC1(CC(O)CO)N=CC=C1Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c18-9-4-8-17(12-16(21)13-20)15(7-10-19-17)11-14-5-2-1-3-6-14/h1-3,5-7,10,16,20-21H,4,8,11-13H2 |
| InChIKey | YJCKATGGYGYMPD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |