C23H20N4O5S — CID 57160579
3-(2-aminoanilino)-6-carbamoyl-2-[(5-hydroxynaphthalen-1-yl)amino]benzenesulfonic acid (PubChem CID 57160579) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 3-(2-aminoanilino)-6-carbamoyl-2-[(5-hydroxynaphthalen-1-yl)amino]benzenesulfonic acid.
| Compound Name | 3-(2-aminoanilino)-6-carbamoyl-2-[(5-hydroxynaphthalen-1-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 57160579 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 3-(2-aminoanilino)-6-carbamoyl-2-[(5-hydroxynaphthalen-1-yl)amino]benzenesulfonic acid |
| SMILES | NC(=O)c1ccc(Nc2ccccc2N)c(Nc2cccc3c(O)cccc23)c1S(=O)(=O)O |
| InChI | InChI=1S/C23H20N4O5S/c24-16-7-1-2-8-18(16)26-19-12-11-15(23(25)29)22(33(30,31)32)21(19)27-17-9-3-6-14-13(17)5-4-10-20(14)28/h1-12,26-28H,24H2,(H2,25,29)(H,30,31,32) |
| InChIKey | DPMNGFGAGRTHRR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|