C22H19N3O7S2 — CID 57228552
4-(3-aminoanilino)-3-[(5-hydroxynaphthalen-2-yl)amino]benzene-1,2-disulfonic acid (PubChem CID 57228552) has the molecular formula C22H19N3O7S2 and a molecular weight of 501.54 g/mol. Its IUPAC name is 4-(3-aminoanilino)-3-[(5-hydroxynaphthalen-2-yl)amino]benzene-1,2-disulfonic acid.
| Compound Name | 4-(3-aminoanilino)-3-[(5-hydroxynaphthalen-2-yl)amino]benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 57228552 |
| Molecular Formula | C22H19N3O7S2 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 4-(3-aminoanilino)-3-[(5-hydroxynaphthalen-2-yl)amino]benzene-1,2-disulfonic acid |
| SMILES | Nc1cccc(Nc2ccc(S(=O)(=O)O)c(S(=O)(=O)O)c2Nc2ccc3c(O)cccc3c2)c1 |
| InChI | InChI=1S/C22H19N3O7S2/c23-14-4-2-5-15(12-14)24-18-9-10-20(33(27,28)29)22(34(30,31)32)21(18)25-16-7-8-17-13(11-16)3-1-6-19(17)26/h1-12,24-26H,23H2,(H,27,28,29)(H,30,31,32) |
| InChIKey | KKFUJNGTNYUAOK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|