C11H11NO4S — CID 141075800
[(5-hydroxynaphthalen-2-yl)amino]methanesulfonic acid (PubChem CID 141075800) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is [(5-hydroxynaphthalen-2-yl)amino]methanesulfonic acid.
| Compound Name | [(5-hydroxynaphthalen-2-yl)amino]methanesulfonic acid |
|---|---|
| PubChem CID | 141075800 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | [(5-hydroxynaphthalen-2-yl)amino]methanesulfonic acid |
| SMILES | O=S(=O)(O)CNc1ccc2c(O)cccc2c1 |
| InChI | InChI=1S/C11H11NO4S/c13-11-3-1-2-8-6-9(4-5-10(8)11)12-7-17(14,15)16/h1-6,12-13H,7H2,(H,14,15,16) |
| InChIKey | VKJXVDUGXXGLGV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|