C24H22N4O5S — CID 57040803
1-(2-aminoanilino)-2-anilino-1-[(5-hydroxynaphthalen-2-yl)amino]-2-oxoethanesulfonic acid (PubChem CID 57040803) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is 1-(2-aminoanilino)-2-anilino-1-[(5-hydroxynaphthalen-2-yl)amino]-2-oxoethanesulfonic acid.
| Compound Name | 1-(2-aminoanilino)-2-anilino-1-[(5-hydroxynaphthalen-2-yl)amino]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 57040803 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 1-(2-aminoanilino)-2-anilino-1-[(5-hydroxynaphthalen-2-yl)amino]-2-oxoethanesulfonic acid |
| SMILES | Nc1ccccc1NC(Nc1ccc2c(O)cccc2c1)(C(=O)Nc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C24H22N4O5S/c25-20-10-4-5-11-21(20)28-24(34(31,32)33,23(30)26-17-8-2-1-3-9-17)27-18-13-14-19-16(15-18)7-6-12-22(19)29/h1-15,27-29H,25H2,(H,26,30)(H,31,32,33) |
| InChIKey | XOQPHBKKTUXWDM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|