C19H23NO2 — CID 57160608
(4S)-4-[(1S)-cyclohex-2-en-1-yl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one (PubChem CID 57160608) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (4S)-4-[(1S)-cyclohex-2-en-1-yl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4S)-4-[(1S)-cyclohex-2-en-1-yl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 57160608 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (4S)-4-[(1S)-cyclohex-2-en-1-yl]-4-(2-methylpropyl)-2-phenyl-1,3-oxazol-5-one |
| SMILES | CC(C)C[C@@]1([C@@H]2C=CCCC2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C19H23NO2/c1-14(2)13-19(16-11-7-4-8-12-16)18(21)22-17(20-19)15-9-5-3-6-10-15/h3,5-7,9-11,14,16H,4,8,12-13H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | MQOKHLMEZVPUFD-APWZRJJASA-N |
| XLogP | 4.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|