C16H18N3S2+ — CID 57161796
4-[1-(1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]butane-1,1-dithiol (PubChem CID 57161796) has the molecular formula C16H18N3S2+ and a molecular weight of 316.48 g/mol. Its IUPAC name is 4-[1-(1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]butane-1,1-dithiol.
| Compound Name | 4-[1-(1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]butane-1,1-dithiol |
|---|---|
| PubChem CID | 57161796 |
| Molecular Formula | C16H18N3S2+ |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-[1-(1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]butane-1,1-dithiol |
| SMILES | SC(S)CCCc1cccc[n+]1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H17N3S2/c20-15(21)10-5-7-12-6-3-4-11-19(12)16-17-13-8-1-2-9-14(13)18-16/h1-4,6,8-9,11,15H,5,7,10H2,(H2-,17,18,20,21)/p+1 |
| InChIKey | ZGLHMXCREVYGDG-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|