About phenanthrene-1-sulfinate
phenanthrene-1-sulfinate (PubChem CID 57162445) has the molecular formula C14H9O2S-
and a molecular weight of 241.29 g/mol. Its IUPAC name is phenanthrene-1-sulfinate.
Molecular Properties
| Compound Name | phenanthrene-1-sulfinate |
| PubChem CID | 57162445 |
| Molecular Formula | C14H9O2S- |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | phenanthrene-1-sulfinate |
| SMILES | O=S([O-])c1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C14H10O2S/c15-17(16)14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H,(H,15,16)/p-1 |
| InChIKey | REGOXHOIBXDVKR-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene-1-sulfinate?
The IUPAC name of phenanthrene-1-sulfinate (CID 57162445) is phenanthrene-1-sulfinate.
What is the SMILES notation for phenanthrene-1-sulfinate?
The canonical SMILES for phenanthrene-1-sulfinate is O=S([O-])c1cccc2c1ccc1ccccc12.
What is the InChIKey of phenanthrene-1-sulfinate?
The InChIKey is REGOXHOIBXDVKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H10O2S/c15-17(16)14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h1-9H,(H,15,16)/p-1.
What are the key properties of phenanthrene-1-sulfinate?
phenanthrene-1-sulfinate has a molecular weight of 241.29 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene-1-sulfinate is sourced from PubChem (CID 57162445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).