About lithium phenanthren-1-olate
lithium phenanthren-1-olate (PubChem CID 23684870) has the molecular formula C14H9LiO
and a molecular weight of 200.17 g/mol. Its IUPAC name is lithium phenanthren-1-olate.
Molecular Properties
| Compound Name | lithium phenanthren-1-olate |
| PubChem CID | 23684870 |
| Molecular Formula | C14H9LiO |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | lithium phenanthren-1-olate |
| SMILES | [Li+].[O-]c1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C14H10O.Li/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14;/h1-9,15H;/q;+1/p-1 |
| InChIKey | KJPDNGVOKOCQEN-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze lithium phenanthren-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium phenanthren-1-olate?
The IUPAC name of lithium phenanthren-1-olate (CID 23684870) is lithium phenanthren-1-olate.
What is the SMILES notation for lithium phenanthren-1-olate?
The canonical SMILES for lithium phenanthren-1-olate is [Li+].[O-]c1cccc2c1ccc1ccccc12.
What is the InChIKey of lithium phenanthren-1-olate?
The InChIKey is KJPDNGVOKOCQEN-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H10O.Li/c15-14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14;/h1-9,15H;/q;+1/p-1.
What are the key properties of lithium phenanthren-1-olate?
lithium phenanthren-1-olate has a molecular weight of 200.17 g/mol, XLogP of 0.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium phenanthren-1-olate is sourced from PubChem (CID 23684870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).