C22H25ClN2O3 — CID 57164142
3-[2-[4-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-1H-indol-3-yl]ethoxyamino]prop-2-en-1-ol (PubChem CID 57164142) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 3-[2-[4-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-1H-indol-3-yl]ethoxyamino]prop-2-en-1-ol.
| Compound Name | 3-[2-[4-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-1H-indol-3-yl]ethoxyamino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 57164142 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-[2-[4-[(4-chlorophenyl)methyl]-5-methoxy-2-methyl-1H-indol-3-yl]ethoxyamino]prop-2-en-1-ol |
| SMILES | COc1ccc2[nH]c(C)c(CCONC=CCO)c2c1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-15-18(10-13-28-24-11-3-12-26)22-19(14-16-4-6-17(23)7-5-16)21(27-2)9-8-20(22)25-15/h3-9,11,24-26H,10,12-14H2,1-2H3 |
| InChIKey | YPEYCUZZHNDLGD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|