C23H22ClN3O8 — CID 69149695
[2-(2-nitrooxyethylamino)-2-oxoethyl] 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate (PubChem CID 69149695) has the molecular formula C23H22ClN3O8 and a molecular weight of 503.90 g/mol. Its IUPAC name is [2-(2-nitrooxyethylamino)-2-oxoethyl] 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate.
| Compound Name | [2-(2-nitrooxyethylamino)-2-oxoethyl] 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 69149695 |
| Molecular Formula | C23H22ClN3O8 |
| Molecular Weight | 503.90 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | [2-(2-nitrooxyethylamino)-2-oxoethyl] 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)OCC(=O)NCCO[N+](=O)[O-])c2c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O8/c1-13-16(11-20(29)34-12-19(28)25-9-10-35-27(31)32)21-17(26-13)7-8-18(33-2)22(21)23(30)14-3-5-15(24)6-4-14/h3-8,26H,9-12H2,1-2H3,(H,25,28) |
| InChIKey | AEYIWNWZAXAPSE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.90 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|