C31H39ClN4O6S — CID 87990988
2-[2-[4-(2-methyl-2-nitrososulfanylpropyl)piperazin-1-yl]ethoxy]ethyl 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate (PubChem CID 87990988) has the molecular formula C31H39ClN4O6S and a molecular weight of 631.20 g/mol. Its IUPAC name is 2-[2-[4-(2-methyl-2-nitrososulfanylpropyl)piperazin-1-yl]ethoxy]ethyl 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate.
| Compound Name | 2-[2-[4-(2-methyl-2-nitrososulfanylpropyl)piperazin-1-yl]ethoxy]ethyl 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 87990988 |
| Molecular Formula | C31H39ClN4O6S |
| Molecular Weight | 631.20 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 2-[2-[4-(2-methyl-2-nitrososulfanylpropyl)piperazin-1-yl]ethoxy]ethyl 2-[4-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)OCCOCCN3CCN(CC(C)(C)SN=O)CC3)c2c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H39ClN4O6S/c1-21-24(28-25(33-21)9-10-26(40-4)29(28)30(38)22-5-7-23(32)8-6-22)19-27(37)42-18-17-41-16-15-35-11-13-36(14-12-35)20-31(2,3)43-34-39/h5-10,33H,11-20H2,1-4H3 |
| InChIKey | WQJDNBLXEPTKCE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.20 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|